C16H19NO4S2 — CID 18397279
(4S)-3-[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 18397279) has the molecular formula C16H19NO4S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is (4S)-3-[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4S)-3-[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 18397279 |
| Molecular Formula | C16H19NO4S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.08 |
| IUPAC Name | (4S)-3-[2-(acetylsulfanylmethyl)-3-phenylpropanoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=O)SCC(Cc1ccccc1)C(=O)N1CSC[C@@H]1C(=O)O |
| InChI | InChI=1S/C16H19NO4S2/c1-11(18)23-8-13(7-12-5-3-2-4-6-12)15(19)17-10-22-9-14(17)16(20)21/h2-6,13-14H,7-10H2,1H3,(H,20,21)/t13?,14-/m1/s1 |
| InChIKey | LOPGRYHQEPGYBA-ARLHGKGLSA-N |
| XLogP | 2.11 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|