C10H15NO4S2 — CID 12889997
(4S)-3-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-1,3-thiazolidine-4-carboxylic acid (PubChem CID 12889997) has the molecular formula C10H15NO4S2 and a molecular weight of 277.37 g/mol. Its IUPAC name is (4S)-3-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4S)-3-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 12889997 |
| Molecular Formula | C10H15NO4S2 |
| Molecular Weight | 277.37 g/mol |
| Exact Mass | 277.04 |
| IUPAC Name | (4S)-3-[(2S)-3-acetylsulfanyl-2-methylpropanoyl]-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=O)SC[C@@H](C)C(=O)N1CSC[C@@H]1C(=O)O |
| InChI | InChI=1S/C10H15NO4S2/c1-6(3-17-7(2)12)9(13)11-5-16-4-8(11)10(14)15/h6,8H,3-5H2,1-2H3,(H,14,15)/t6-,8-/m1/s1 |
| InChIKey | YACVCCXVPMISTO-HTRCEHHLSA-N |
| XLogP | 0.89 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.37 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|