C17H25NO4S3 — CID 54023653
(2'S)-1'-(3-acetylsulfanyl-2-methylpropanoyl)spiro[3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]dithiole-2,4'-pyrrolidine]-2'-carboxylic acid (PubChem CID 54023653) has the molecular formula C17H25NO4S3 and a molecular weight of 403.59 g/mol. Its IUPAC name is (2'S)-1'-(3-acetylsulfanyl-2-methylpropanoyl)spiro[3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]dithiole-2,4'-pyrrolidine]-2'-carboxylic acid.
| Compound Name | (2'S)-1'-(3-acetylsulfanyl-2-methylpropanoyl)spiro[3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]dithiole-2,4'-pyrrolidine]-2'-carboxylic acid |
|---|---|
| PubChem CID | 54023653 |
| Molecular Formula | C17H25NO4S3 |
| Molecular Weight | 403.59 g/mol |
| Exact Mass | 403.09 |
| IUPAC Name | (2'S)-1'-(3-acetylsulfanyl-2-methylpropanoyl)spiro[3a,4,5,6,7,7a-hexahydrobenzo[d][1,3]dithiole-2,4'-pyrrolidine]-2'-carboxylic acid |
| SMILES | CC(=O)SCC(C)C(=O)N1CC2(C[C@H]1C(=O)O)SC1CCCCC1S2 |
| InChI | InChI=1S/C17H25NO4S3/c1-10(8-23-11(2)19)15(20)18-9-17(7-12(18)16(21)22)24-13-5-3-4-6-14(13)25-17/h10,12-14H,3-9H2,1-2H3,(H,21,22)/t10?,12-,13?,14?,17?/m0/s1 |
| InChIKey | LAQNMGWVGFMACC-AABCLZRXSA-N |
| XLogP | 3.08 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.59 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|