C14H23NO6S — CID 20554187
1-(3-acetylsulfanyl-2-methylpropanoyl)-5,5-dimethoxypiperidine-2-carboxylic acid (PubChem CID 20554187) has the molecular formula C14H23NO6S and a molecular weight of 333.41 g/mol. Its IUPAC name is 1-(3-acetylsulfanyl-2-methylpropanoyl)-5,5-dimethoxypiperidine-2-carboxylic acid.
| Compound Name | 1-(3-acetylsulfanyl-2-methylpropanoyl)-5,5-dimethoxypiperidine-2-carboxylic acid |
|---|---|
| PubChem CID | 20554187 |
| Molecular Formula | C14H23NO6S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | 1-(3-acetylsulfanyl-2-methylpropanoyl)-5,5-dimethoxypiperidine-2-carboxylic acid |
| SMILES | COC1(OC)CCC(C(=O)O)N(C(=O)C(C)CSC(C)=O)C1 |
| InChI | InChI=1S/C14H23NO6S/c1-9(7-22-10(2)16)12(17)15-8-14(20-3,21-4)6-5-11(15)13(18)19/h9,11H,5-8H2,1-4H3,(H,18,19) |
| InChIKey | PWWWKFNIJHWREV-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|