C17H23NO4S — CID 88748156
(2S)-1-(3-acetylsulfanyl-2-methylpropanoyl)-4-cyclohexa-1,4-dien-1-ylpyrrolidine-2-carboxylic acid (PubChem CID 88748156) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is (2S)-1-(3-acetylsulfanyl-2-methylpropanoyl)-4-cyclohexa-1,4-dien-1-ylpyrrolidine-2-carboxylic acid.
| Compound Name | (2S)-1-(3-acetylsulfanyl-2-methylpropanoyl)-4-cyclohexa-1,4-dien-1-ylpyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 88748156 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | (2S)-1-(3-acetylsulfanyl-2-methylpropanoyl)-4-cyclohexa-1,4-dien-1-ylpyrrolidine-2-carboxylic acid |
| SMILES | CC(=O)SCC(C)C(=O)N1CC(C2=CCC=CC2)C[C@H]1C(=O)O |
| InChI | InChI=1S/C17H23NO4S/c1-11(10-23-12(2)19)16(20)18-9-14(8-15(18)17(21)22)13-6-4-3-5-7-13/h3-4,7,11,14-15H,5-6,8-10H2,1-2H3,(H,21,22)/t11?,14?,15-/m0/s1 |
| InChIKey | UTUHVJCUMMEREP-KWCHVYNWSA-N |
| XLogP | 2.48 |
| TPSA | 74.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|