C16H14Cl2N2O6S — CID 12818267
methyl N-[4-[[2-(3,5-dichlorophenoxy)acetyl]amino]phenyl]sulfonylcarbamate (PubChem CID 12818267) has the molecular formula C16H14Cl2N2O6S and a molecular weight of 433.27 g/mol. Its IUPAC name is methyl N-[4-[[2-(3,5-dichlorophenoxy)acetyl]amino]phenyl]sulfonylcarbamate.
| Compound Name | methyl N-[4-[[2-(3,5-dichlorophenoxy)acetyl]amino]phenyl]sulfonylcarbamate |
|---|---|
| PubChem CID | 12818267 |
| Molecular Formula | C16H14Cl2N2O6S |
| Molecular Weight | 433.27 g/mol |
| Exact Mass | 431.99 |
| IUPAC Name | methyl N-[4-[[2-(3,5-dichlorophenoxy)acetyl]amino]phenyl]sulfonylcarbamate |
| SMILES | COC(=O)NS(=O)(=O)c1ccc(NC(=O)COc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C16H14Cl2N2O6S/c1-25-16(22)20-27(23,24)14-4-2-12(3-5-14)19-15(21)9-26-13-7-10(17)6-11(18)8-13/h2-8H,9H2,1H3,(H,19,21)(H,20,22) |
| InChIKey | IZAJBHQZQNCLOX-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.27 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |