About [formyl(methyl)amino] thiohypochlorite
[formyl(methyl)amino] thiohypochlorite (PubChem CID 12819418) has the molecular formula C2H4ClNOS
and a molecular weight of 125.58 g/mol. Its IUPAC name is [formyl(methyl)amino] thiohypochlorite.
Molecular Properties
| Compound Name | [formyl(methyl)amino] thiohypochlorite |
| PubChem CID | 12819418 |
| Molecular Formula | C2H4ClNOS |
| Molecular Weight | 125.58 g/mol |
| Exact Mass | 124.97 |
| IUPAC Name | [formyl(methyl)amino] thiohypochlorite |
| SMILES | CN(C=O)SCl |
| InChI | InChI=1S/C2H4ClNOS/c1-4(2-5)6-3/h2H,1H3 |
| InChIKey | PHVFLGITSDWMKI-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.58 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [formyl(methyl)amino] thiohypochlorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [formyl(methyl)amino] thiohypochlorite?
The IUPAC name of [formyl(methyl)amino] thiohypochlorite (CID 12819418) is [formyl(methyl)amino] thiohypochlorite.
What is the SMILES notation for [formyl(methyl)amino] thiohypochlorite?
The canonical SMILES for [formyl(methyl)amino] thiohypochlorite is CN(C=O)SCl.
What is the InChIKey of [formyl(methyl)amino] thiohypochlorite?
The InChIKey is PHVFLGITSDWMKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4ClNOS/c1-4(2-5)6-3/h2H,1H3.
What are the key properties of [formyl(methyl)amino] thiohypochlorite?
[formyl(methyl)amino] thiohypochlorite has a molecular weight of 125.58 g/mol, XLogP of 0.88, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [formyl(methyl)amino] thiohypochlorite is sourced from PubChem (CID 12819418), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).