About [formyl(methyl)amino] thiohypofluorite
[formyl(methyl)amino] thiohypofluorite (PubChem CID 178055808) has the molecular formula C2H4FNOS
and a molecular weight of 109.12 g/mol. Its IUPAC name is [formyl(methyl)amino] thiohypofluorite.
Molecular Properties
| Compound Name | [formyl(methyl)amino] thiohypofluorite |
| PubChem CID | 178055808 |
| Molecular Formula | C2H4FNOS |
| Molecular Weight | 109.12 g/mol |
| Exact Mass | 109.00 |
| IUPAC Name | [formyl(methyl)amino] thiohypofluorite |
| SMILES | CN(C=O)SF |
| InChI | InChI=1S/C2H4FNOS/c1-4(2-5)6-3/h2H,1H3 |
| InChIKey | LZRUJTOVVGYRRO-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.12 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [formyl(methyl)amino] thiohypofluorite with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [formyl(methyl)amino] thiohypofluorite?
The IUPAC name of [formyl(methyl)amino] thiohypofluorite (CID 178055808) is [formyl(methyl)amino] thiohypofluorite.
What is the SMILES notation for [formyl(methyl)amino] thiohypofluorite?
The canonical SMILES for [formyl(methyl)amino] thiohypofluorite is CN(C=O)SF.
What is the InChIKey of [formyl(methyl)amino] thiohypofluorite?
The InChIKey is LZRUJTOVVGYRRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H4FNOS/c1-4(2-5)6-3/h2H,1H3.
What are the key properties of [formyl(methyl)amino] thiohypofluorite?
[formyl(methyl)amino] thiohypofluorite has a molecular weight of 109.12 g/mol, XLogP of 0.61, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [formyl(methyl)amino] thiohypofluorite is sourced from PubChem (CID 178055808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).