C11H20S — CID 12819902
(6Z)-6,7,9-trimethyl-2,3,4,5,8,9-hexahydrothionine (PubChem CID 12819902) has the molecular formula C11H20S and a molecular weight of 184.35 g/mol. Its IUPAC name is (6Z)-6,7,9-trimethyl-2,3,4,5,8,9-hexahydrothionine.
| Compound Name | (6Z)-6,7,9-trimethyl-2,3,4,5,8,9-hexahydrothionine |
|---|---|
| PubChem CID | 12819902 |
| Molecular Formula | C11H20S |
| Molecular Weight | 184.35 g/mol |
| Exact Mass | 184.13 |
| IUPAC Name | (6Z)-6,7,9-trimethyl-2,3,4,5,8,9-hexahydrothionine |
| SMILES | C/C1=C(\C)CC(C)SCCCC1 |
| InChI | InChI=1S/C11H20S/c1-9-6-4-5-7-12-11(3)8-10(9)2/h11H,4-8H2,1-3H3/b10-9- |
| InChIKey | DYGFCTPLEQIFDV-KTKRTIGZSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.35 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|