C18H25NO4 — CID 12821891
pentyl 2-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxy]butanoate (PubChem CID 12821891) has the molecular formula C18H25NO4 and a molecular weight of 319.40 g/mol. Its IUPAC name is pentyl 2-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxy]butanoate.
| Compound Name | pentyl 2-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxy]butanoate |
|---|---|
| PubChem CID | 12821891 |
| Molecular Formula | C18H25NO4 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | pentyl 2-[(2-oxo-3,4-dihydro-1H-quinolin-7-yl)oxy]butanoate |
| SMILES | CCCCCOC(=O)C(CC)Oc1ccc2c(c1)NC(=O)CC2 |
| InChI | InChI=1S/C18H25NO4/c1-3-5-6-11-22-18(21)16(4-2)23-14-9-7-13-8-10-17(20)19-15(13)12-14/h7,9,12,16H,3-6,8,10-11H2,1-2H3,(H,19,20) |
| InChIKey | KLZWRDGCAPDEIY-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|