About trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate
trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate (PubChem CID 12824427) has the molecular formula C13H20O5SSi
and a molecular weight of 316.45 g/mol. Its IUPAC name is trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate.
Molecular Properties
| Compound Name | trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate |
| PubChem CID | 12824427 |
| Molecular Formula | C13H20O5SSi |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.08 |
| IUPAC Name | trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate |
| SMILES | CO[Si](COC(=O)CSc1ccc(C)cc1)(OC)OC |
| InChI | InChI=1S/C13H20O5SSi/c1-11-5-7-12(8-6-11)19-9-13(14)18-10-20(15-2,16-3)17-4/h5-8H,9-10H2,1-4H3 |
| InChIKey | IRYGEPSEQXFENK-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate?
The IUPAC name of trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate (CID 12824427) is trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate.
What is the SMILES notation for trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate?
The canonical SMILES for trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate is CO[Si](COC(=O)CSc1ccc(C)cc1)(OC)OC.
What is the InChIKey of trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate?
The InChIKey is IRYGEPSEQXFENK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H20O5SSi/c1-11-5-7-12(8-6-11)19-9-13(14)18-10-20(15-2,16-3)17-4/h5-8H,9-10H2,1-4H3.
What are the key properties of trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate?
trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate has a molecular weight of 316.45 g/mol, XLogP of 2.05, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for trimethoxysilylmethyl 2-(4-methylphenyl)sulfanylacetate is sourced from PubChem (CID 12824427), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).