About 4-phenylchromenylium
4-phenylchromenylium (PubChem CID 12828704) has the molecular formula C15H11O+
and a molecular weight of 207.25 g/mol. Its IUPAC name is 4-phenylchromenylium.
Molecular Properties
| Compound Name | 4-phenylchromenylium |
| PubChem CID | 12828704 |
| Molecular Formula | C15H11O+ |
| Molecular Weight | 207.25 g/mol |
| Exact Mass | 207.08 |
| IUPAC Name | 4-phenylchromenylium |
| SMILES | c1ccc(-c2cc[o+]c3ccccc23)cc1 |
| InChI | InChI=1S/C15H11O/c1-2-6-12(7-3-1)13-10-11-16-15-9-5-4-8-14(13)15/h1-11H/q+1 |
| InChIKey | DMSVRSLWBYVQSN-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 207.25 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze 4-phenylchromenylium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-phenylchromenylium?
The IUPAC name of 4-phenylchromenylium (CID 12828704) is 4-phenylchromenylium.
What is the SMILES notation for 4-phenylchromenylium?
The canonical SMILES for 4-phenylchromenylium is c1ccc(-c2cc[o+]c3ccccc23)cc1.
What is the InChIKey of 4-phenylchromenylium?
The InChIKey is DMSVRSLWBYVQSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H11O/c1-2-6-12(7-3-1)13-10-11-16-15-9-5-4-8-14(13)15/h1-11H/q+1.
What are the key properties of 4-phenylchromenylium?
4-phenylchromenylium has a molecular weight of 207.25 g/mol, XLogP of 4.38, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 4-phenylchromenylium is sourced from PubChem (CID 12828704), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).