C13H17BrN2 — CID 12828939
(1E,3E)-4-(5-bromo-2-pyridinyl)-N,N-diethylbuta-1,3-dien-1-amine (PubChem CID 12828939) has the molecular formula C13H17BrN2 and a molecular weight of 281.20 g/mol. Its IUPAC name is (1E,3E)-4-(5-bromo-2-pyridinyl)-N,N-diethylbuta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-4-(5-bromo-2-pyridinyl)-N,N-diethylbuta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 12828939 |
| Molecular Formula | C13H17BrN2 |
| Molecular Weight | 281.20 g/mol |
| Exact Mass | 280.06 |
| IUPAC Name | (1E,3E)-4-(5-bromo-2-pyridinyl)-N,N-diethylbuta-1,3-dien-1-amine |
| SMILES | CCN(/C=C/C=C/c1ccc(Br)cn1)CC |
| InChI | InChI=1S/C13H17BrN2/c1-3-16(4-2)10-6-5-7-13-9-8-12(14)11-15-13/h5-11H,3-4H2,1-2H3/b7-5+,10-6+ |
| InChIKey | ASXSWXJVQGTPFI-YLNKAEQOSA-N |
| XLogP | 3.71 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.20 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|