C19H11F8NO — CID 12831594
2-[4,5-bis(4-fluorophenyl)-1H-pyrrol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol (PubChem CID 12831594) has the molecular formula C19H11F8NO and a molecular weight of 421.29 g/mol. Its IUPAC name is 2-[4,5-bis(4-fluorophenyl)-1H-pyrrol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol.
| Compound Name | 2-[4,5-bis(4-fluorophenyl)-1H-pyrrol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
|---|---|
| PubChem CID | 12831594 |
| Molecular Formula | C19H11F8NO |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 421.07 |
| IUPAC Name | 2-[4,5-bis(4-fluorophenyl)-1H-pyrrol-2-yl]-1,1,1,3,3,3-hexafluoropropan-2-ol |
| SMILES | OC(c1cc(-c2ccc(F)cc2)c(-c2ccc(F)cc2)[nH]1)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C19H11F8NO/c20-12-5-1-10(2-6-12)14-9-15(17(29,18(22,23)24)19(25,26)27)28-16(14)11-3-7-13(21)8-4-11/h1-9,28-29H |
| InChIKey | KMWBRCNGXGLQTB-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |