C17H20F3NO — CID 24794050
1-[3-ethyl-5-(trifluoromethyl)-1H-indol-2-yl]cyclohexan-1-ol (PubChem CID 24794050) has the molecular formula C17H20F3NO and a molecular weight of 311.35 g/mol. Its IUPAC name is 1-[3-ethyl-5-(trifluoromethyl)-1H-indol-2-yl]cyclohexan-1-ol.
| Compound Name | 1-[3-ethyl-5-(trifluoromethyl)-1H-indol-2-yl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 24794050 |
| Molecular Formula | C17H20F3NO |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 1-[3-ethyl-5-(trifluoromethyl)-1H-indol-2-yl]cyclohexan-1-ol |
| SMILES | CCc1c(C2(O)CCCCC2)[nH]c2ccc(C(F)(F)F)cc12 |
| InChI | InChI=1S/C17H20F3NO/c1-2-12-13-10-11(17(18,19)20)6-7-14(13)21-15(12)16(22)8-4-3-5-9-16/h6-7,10,21-22H,2-5,8-9H2,1H3 |
| InChIKey | CQRWZLUKOOUZNU-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |