C24H20ClN3O2 — CID 1283219
2-chloro-4-(2,5-dimethylpyrrol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide (PubChem CID 1283219) has the molecular formula C24H20ClN3O2 and a molecular weight of 417.90 g/mol. Its IUPAC name is 2-chloro-4-(2,5-dimethylpyrrol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide.
| Compound Name | 2-chloro-4-(2,5-dimethylpyrrol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 1283219 |
| Molecular Formula | C24H20ClN3O2 |
| Molecular Weight | 417.90 g/mol |
| Exact Mass | 417.12 |
| IUPAC Name | 2-chloro-4-(2,5-dimethylpyrrol-1-yl)-N-[(2-hydroxynaphthalen-1-yl)methylideneamino]benzamide |
| SMILES | Cc1ccc(C)n1-c1ccc(C(=O)NN=Cc2c(O)ccc3ccccc23)c(Cl)c1 |
| InChI | InChI=1S/C24H20ClN3O2/c1-15-7-8-16(2)28(15)18-10-11-20(22(25)13-18)24(30)27-26-14-21-19-6-4-3-5-17(19)9-12-23(21)29/h3-14,29H,1-2H3,(H,27,30) |
| InChIKey | SHGAUMMFUURYRT-UHFFFAOYSA-N |
| XLogP | 5.37 |
| TPSA | 66.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.90 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|