C10H14O — CID 12835791
(1R,7S)-8,8-dimethylbicyclo[5.1.0]oct-2-en-4-one (PubChem CID 12835791) has the molecular formula C10H14O and a molecular weight of 150.22 g/mol. Its IUPAC name is (1R,7S)-8,8-dimethylbicyclo[5.1.0]oct-2-en-4-one.
| Compound Name | (1R,7S)-8,8-dimethylbicyclo[5.1.0]oct-2-en-4-one |
|---|---|
| PubChem CID | 12835791 |
| Molecular Formula | C10H14O |
| Molecular Weight | 150.22 g/mol |
| Exact Mass | 150.10 |
| IUPAC Name | (1R,7S)-8,8-dimethylbicyclo[5.1.0]oct-2-en-4-one |
| SMILES | CC1(C)[C@@H]2C=CC(=O)CC[C@@H]21 |
| InChI | InChI=1S/C10H14O/c1-10(2)8-5-3-7(11)4-6-9(8)10/h3,5,8-9H,4,6H2,1-2H3/t8-,9+/m1/s1 |
| InChIKey | KWJOKSSVHGTBHD-BDAKNGLRSA-N |
| XLogP | 2.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 150.22 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |