C16H17NO2 — CID 12840012
(4R)-4-[(1S)-cyclohex-2-en-1-yl]-4-methyl-2-phenyl-1,3-oxazol-5-one (PubChem CID 12840012) has the molecular formula C16H17NO2 and a molecular weight of 255.32 g/mol. Its IUPAC name is (4R)-4-[(1S)-cyclohex-2-en-1-yl]-4-methyl-2-phenyl-1,3-oxazol-5-one.
| Compound Name | (4R)-4-[(1S)-cyclohex-2-en-1-yl]-4-methyl-2-phenyl-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 12840012 |
| Molecular Formula | C16H17NO2 |
| Molecular Weight | 255.32 g/mol |
| Exact Mass | 255.13 |
| IUPAC Name | (4R)-4-[(1S)-cyclohex-2-en-1-yl]-4-methyl-2-phenyl-1,3-oxazol-5-one |
| SMILES | C[C@]1([C@@H]2C=CCCC2)N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C16H17NO2/c1-16(13-10-6-3-7-11-13)15(18)19-14(17-16)12-8-4-2-5-9-12/h2,4-6,8-10,13H,3,7,11H2,1H3/t13-,16-/m1/s1 |
| InChIKey | PGZJTCFEIFNECJ-CZUORRHYSA-N |
| XLogP | 3.11 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|