C8H14N2 — CID 12840741
1,4-dimethyl-2,3-dimethylidenepiperazine (PubChem CID 12840741) has the molecular formula C8H14N2 and a molecular weight of 138.21 g/mol. Its IUPAC name is 1,4-dimethyl-2,3-dimethylidenepiperazine.
| Compound Name | 1,4-dimethyl-2,3-dimethylidenepiperazine |
|---|---|
| PubChem CID | 12840741 |
| Molecular Formula | C8H14N2 |
| Molecular Weight | 138.21 g/mol |
| Exact Mass | 138.12 |
| IUPAC Name | 1,4-dimethyl-2,3-dimethylidenepiperazine |
| SMILES | C=C1C(=C)N(C)CCN1C |
| InChI | InChI=1S/C8H14N2/c1-7-8(2)10(4)6-5-9(7)3/h1-2,5-6H2,3-4H3 |
| InChIKey | IERXMCTVGIIBLE-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 138.21 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |