C7H14N2 — CID 54488727
1,4-dimethyl-2-methylidenepiperazine (PubChem CID 54488727) has the molecular formula C7H14N2 and a molecular weight of 126.20 g/mol. Its IUPAC name is 1,4-dimethyl-2-methylidenepiperazine.
| Compound Name | 1,4-dimethyl-2-methylidenepiperazine |
|---|---|
| PubChem CID | 54488727 |
| Molecular Formula | C7H14N2 |
| Molecular Weight | 126.20 g/mol |
| Exact Mass | 126.12 |
| IUPAC Name | 1,4-dimethyl-2-methylidenepiperazine |
| SMILES | C=C1CN(C)CCN1C |
| InChI | InChI=1S/C7H14N2/c1-7-6-8(2)4-5-9(7)3/h1,4-6H2,2-3H3 |
| InChIKey | XUFVFXUIFKQBGD-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.20 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |