About (3-bromophenyl)methyl methanesulfonate
(3-bromophenyl)methyl methanesulfonate (PubChem CID 12844395) has the molecular formula C8H9BrO3S
and a molecular weight of 265.13 g/mol. Its IUPAC name is (3-bromophenyl)methyl methanesulfonate.
Molecular Properties
| Compound Name | (3-bromophenyl)methyl methanesulfonate |
| PubChem CID | 12844395 |
| Molecular Formula | C8H9BrO3S |
| Molecular Weight | 265.13 g/mol |
| Exact Mass | 263.95 |
| IUPAC Name | (3-bromophenyl)methyl methanesulfonate |
| SMILES | CS(=O)(=O)OCc1cccc(Br)c1 |
| InChI | InChI=1S/C8H9BrO3S/c1-13(10,11)12-6-7-3-2-4-8(9)5-7/h2-5H,6H2,1H3 |
| InChIKey | FKWAPFZJCTVKNJ-UHFFFAOYSA-N |
| XLogP | 1.93 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.13 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze (3-bromophenyl)methyl methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromophenyl)methyl methanesulfonate?
The IUPAC name of (3-bromophenyl)methyl methanesulfonate (CID 12844395) is (3-bromophenyl)methyl methanesulfonate.
What is the SMILES notation for (3-bromophenyl)methyl methanesulfonate?
The canonical SMILES for (3-bromophenyl)methyl methanesulfonate is CS(=O)(=O)OCc1cccc(Br)c1.
What is the InChIKey of (3-bromophenyl)methyl methanesulfonate?
The InChIKey is FKWAPFZJCTVKNJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9BrO3S/c1-13(10,11)12-6-7-3-2-4-8(9)5-7/h2-5H,6H2,1H3.
What are the key properties of (3-bromophenyl)methyl methanesulfonate?
(3-bromophenyl)methyl methanesulfonate has a molecular weight of 265.13 g/mol, XLogP of 1.93, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromophenyl)methyl methanesulfonate is sourced from PubChem (CID 12844395), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).