About CID 12844421
CID 12844421 (PubChem CID 12844421) has the molecular formula C3H5O2P
and a molecular weight of 104.05 g/mol.
Molecular Properties
| Compound Name | CID 12844421 |
| PubChem CID | 12844421 |
| Molecular Formula | C3H5O2P |
| Molecular Weight | 104.05 g/mol |
| Exact Mass | 104.00 |
| IUPAC Name | — |
| SMILES | C=CCP(=O)=O |
| InChI | InChI=1S/C3H5O2P/c1-2-3-6(4)5/h2H,1,3H2 |
| InChIKey | VPYWTEZKVFVRMC-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 104.05 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze CID 12844421 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 12844421?
The IUPAC name of CID 12844421 (CID 12844421) is not available.
What is the SMILES notation for CID 12844421?
The canonical SMILES for CID 12844421 is C=CCP(=O)=O.
What is the InChIKey of CID 12844421?
The InChIKey is VPYWTEZKVFVRMC-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H5O2P/c1-2-3-6(4)5/h2H,1,3H2.
What are the key properties of CID 12844421?
CID 12844421 has a molecular weight of 104.05 g/mol, XLogP of 1.35, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for CID 12844421 is sourced from PubChem (CID 12844421), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).