About indigane;tris(prop-2-enyl)phosphane
indigane;tris(prop-2-enyl)phosphane (PubChem CID 173012611) has the molecular formula C9H18InP
and a molecular weight of 272.04 g/mol. Its IUPAC name is indigane;tris(prop-2-enyl)phosphane.
Molecular Properties
| Compound Name | indigane;tris(prop-2-enyl)phosphane |
| PubChem CID | 173012611 |
| Molecular Formula | C9H18InP |
| Molecular Weight | 272.04 g/mol |
| Exact Mass | 272.02 |
| IUPAC Name | indigane;tris(prop-2-enyl)phosphane |
| SMILES | C=CCP(CC=C)CC=C.[InH3] |
| InChI | InChI=1S/C9H15P.In.3H/c1-4-7-10(8-5-2)9-6-3;;;;/h4-6H,1-3,7-9H2;;;; |
| InChIKey | VEBBGIQAZHSCGK-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.04 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze indigane;tris(prop-2-enyl)phosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of indigane;tris(prop-2-enyl)phosphane?
The IUPAC name of indigane;tris(prop-2-enyl)phosphane (CID 173012611) is indigane;tris(prop-2-enyl)phosphane.
What is the SMILES notation for indigane;tris(prop-2-enyl)phosphane?
The canonical SMILES for indigane;tris(prop-2-enyl)phosphane is C=CCP(CC=C)CC=C.[InH3].
What is the InChIKey of indigane;tris(prop-2-enyl)phosphane?
The InChIKey is VEBBGIQAZHSCGK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15P.In.3H/c1-4-7-10(8-5-2)9-6-3;;;;/h4-6H,1-3,7-9H2;;;;.
What are the key properties of indigane;tris(prop-2-enyl)phosphane?
indigane;tris(prop-2-enyl)phosphane has a molecular weight of 272.04 g/mol, XLogP of 1.84, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for indigane;tris(prop-2-enyl)phosphane is sourced from PubChem (CID 173012611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).