C10H13N3O3 — CID 12848803
5-(piperidine-1-carbonyl)-1H-pyrimidine-2,4-dione (PubChem CID 12848803) has the molecular formula C10H13N3O3 and a molecular weight of 223.23 g/mol. Its IUPAC name is 5-(piperidine-1-carbonyl)-1H-pyrimidine-2,4-dione.
| Compound Name | 5-(piperidine-1-carbonyl)-1H-pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 12848803 |
| Molecular Formula | C10H13N3O3 |
| Molecular Weight | 223.23 g/mol |
| Exact Mass | 223.10 |
| IUPAC Name | 5-(piperidine-1-carbonyl)-1H-pyrimidine-2,4-dione |
| SMILES | O=C(c1c[nH]c(=O)[nH]c1=O)N1CCCCC1 |
| InChI | InChI=1S/C10H13N3O3/c14-8-7(6-11-10(16)12-8)9(15)13-4-2-1-3-5-13/h6H,1-5H2,(H2,11,12,14,16) |
| InChIKey | WFISVDCXJUKGBU-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 86.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.23 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |