C19H30N6 — CID 128507735
3-[1-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]piperidin-3-yl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine (PubChem CID 128507735) has the molecular formula C19H30N6 and a molecular weight of 342.49 g/mol. Its IUPAC name is 3-[1-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]piperidin-3-yl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine.
| Compound Name | 3-[1-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]piperidin-3-yl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine |
|---|---|
| PubChem CID | 128507735 |
| Molecular Formula | C19H30N6 |
| Molecular Weight | 342.49 g/mol |
| Exact Mass | 342.25 |
| IUPAC Name | 3-[1-[(3-tert-butyl-1H-1,2,4-triazol-5-yl)methyl]piperidin-3-yl]-5,6,7,8-tetrahydroimidazo[1,5-a]pyridine |
| SMILES | CC(C)(C)c1n[nH]c(CN2CCCC(c3ncc4n3CCCC4)C2)n1 |
| InChI | InChI=1S/C19H30N6/c1-19(2,3)18-21-16(22-23-18)13-24-9-6-7-14(12-24)17-20-11-15-8-4-5-10-25(15)17/h11,14H,4-10,12-13H2,1-3H3,(H,21,22,23) |
| InChIKey | WXKAUTCNRPKKHT-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 62.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.49 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |