C18H23N5O2 — CID 125141397
4-nitro-3-[(3R)-3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)piperidin-1-yl]aniline (PubChem CID 125141397) has the molecular formula C18H23N5O2 and a molecular weight of 341.41 g/mol. Its IUPAC name is 4-nitro-3-[(3R)-3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)piperidin-1-yl]aniline.
| Compound Name | 4-nitro-3-[(3R)-3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)piperidin-1-yl]aniline |
|---|---|
| PubChem CID | 125141397 |
| Molecular Formula | C18H23N5O2 |
| Molecular Weight | 341.41 g/mol |
| Exact Mass | 341.19 |
| IUPAC Name | 4-nitro-3-[(3R)-3-(5,6,7,8-tetrahydroimidazo[1,5-a]pyridin-3-yl)piperidin-1-yl]aniline |
| SMILES | Nc1ccc([N+](=O)[O-])c(N2CCC[C@@H](c3ncc4n3CCCC4)C2)c1 |
| InChI | InChI=1S/C18H23N5O2/c19-14-6-7-16(23(24)25)17(10-14)21-8-3-4-13(12-21)18-20-11-15-5-1-2-9-22(15)18/h6-7,10-11,13H,1-5,8-9,12,19H2/t13-/m1/s1 |
| InChIKey | LQKHNSABECAKJK-CYBMUJFWSA-N |
| XLogP | 3.09 |
| TPSA | 90.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|