C16H14BrN — CID 12851821
1-(4-bromophenyl)-5-methyl-3,4-dihydroisoquinoline (PubChem CID 12851821) has the molecular formula C16H14BrN and a molecular weight of 300.20 g/mol. Its IUPAC name is 1-(4-bromophenyl)-5-methyl-3,4-dihydroisoquinoline.
| Compound Name | 1-(4-bromophenyl)-5-methyl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 12851821 |
| Molecular Formula | C16H14BrN |
| Molecular Weight | 300.20 g/mol |
| Exact Mass | 299.03 |
| IUPAC Name | 1-(4-bromophenyl)-5-methyl-3,4-dihydroisoquinoline |
| SMILES | Cc1cccc2c1CCN=C2c1ccc(Br)cc1 |
| InChI | InChI=1S/C16H14BrN/c1-11-3-2-4-15-14(11)9-10-18-16(15)12-5-7-13(17)8-6-12/h2-8H,9-10H2,1H3 |
| InChIKey | BIKXKQNMJDGCBD-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.20 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |