C10H10BrN — CID 58416380
6-bromo-1-methyl-3,4-dihydroisoquinoline (PubChem CID 58416380) has the molecular formula C10H10BrN and a molecular weight of 224.10 g/mol. Its IUPAC name is 6-bromo-1-methyl-3,4-dihydroisoquinoline.
| Compound Name | 6-bromo-1-methyl-3,4-dihydroisoquinoline |
|---|---|
| PubChem CID | 58416380 |
| Molecular Formula | C10H10BrN |
| Molecular Weight | 224.10 g/mol |
| Exact Mass | 223.00 |
| IUPAC Name | 6-bromo-1-methyl-3,4-dihydroisoquinoline |
| SMILES | CC1=NCCc2cc(Br)ccc21 |
| InChI | InChI=1S/C10H10BrN/c1-7-10-3-2-9(11)6-8(10)4-5-12-7/h2-3,6H,4-5H2,1H3 |
| InChIKey | HWACKXASTKUDLO-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.10 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |