About 7-ethenylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one
7-ethenylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 12853439) has the molecular formula C9H11NO
and a molecular weight of 149.19 g/mol. Its IUPAC name is 7-ethenylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one.
Analyze 7-ethenylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-ethenylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one?
The IUPAC name of 7-ethenylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one (CID 12853439) is 7-ethenylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one.
What is the SMILES notation for 7-ethenylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one?
The canonical SMILES for 7-ethenylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one is C=C=C1CCN2C(=O)CCC12.
What is the InChIKey of 7-ethenylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one?
The InChIKey is NOFYXGMQSBVAPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO/c1-2-7-5-6-10-8(7)3-4-9(10)11/h8H,1,3-6H2.
What are the key properties of 7-ethenylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one?
7-ethenylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one has a molecular weight of 149.19 g/mol, XLogP of 1.09, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-ethenylidene-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one is sourced from PubChem (CID 12853439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).