C11H19NOSi — CID 12842580
(7E)-7-(trimethylsilylmethylidene)-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 12842580) has the molecular formula C11H19NOSi and a molecular weight of 209.36 g/mol. Its IUPAC name is (7E)-7-(trimethylsilylmethylidene)-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (7E)-7-(trimethylsilylmethylidene)-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 12842580 |
| Molecular Formula | C11H19NOSi |
| Molecular Weight | 209.36 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | (7E)-7-(trimethylsilylmethylidene)-2,5,6,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C[Si](C)(C)/C=C1\CCN2C(=O)CCC12 |
| InChI | InChI=1S/C11H19NOSi/c1-14(2,3)8-9-6-7-12-10(9)4-5-11(12)13/h8,10H,4-7H2,1-3H3/b9-8+ |
| InChIKey | IZFXBRKMQCAHPB-CMDGGOBGSA-N |
| XLogP | 2.18 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|