C8H11NO — CID 101426895
(8S)-2-methylidene-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one (PubChem CID 101426895) has the molecular formula C8H11NO and a molecular weight of 137.18 g/mol. Its IUPAC name is (8S)-2-methylidene-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one.
| Compound Name | (8S)-2-methylidene-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
|---|---|
| PubChem CID | 101426895 |
| Molecular Formula | C8H11NO |
| Molecular Weight | 137.18 g/mol |
| Exact Mass | 137.08 |
| IUPAC Name | (8S)-2-methylidene-5,6,7,8-tetrahydro-1H-pyrrolizin-3-one |
| SMILES | C=C1C[C@@H]2CCCN2C1=O |
| InChI | InChI=1S/C8H11NO/c1-6-5-7-3-2-4-9(7)8(6)10/h7H,1-5H2/t7-/m0/s1 |
| InChIKey | PDMPLASCBBZUHT-ZETCQYMHSA-N |
| XLogP | 0.94 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.18 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|