C12H18FNO — CID 128540283
N-[(1R,2S)-2-fluorocyclopentyl]cyclohexene-1-carboxamide (PubChem CID 128540283) has the molecular formula C12H18FNO and a molecular weight of 211.28 g/mol. Its IUPAC name is N-[(1R,2S)-2-fluorocyclopentyl]cyclohexene-1-carboxamide.
| Compound Name | N-[(1R,2S)-2-fluorocyclopentyl]cyclohexene-1-carboxamide |
|---|---|
| PubChem CID | 128540283 |
| Molecular Formula | C12H18FNO |
| Molecular Weight | 211.28 g/mol |
| Exact Mass | 211.14 |
| IUPAC Name | N-[(1R,2S)-2-fluorocyclopentyl]cyclohexene-1-carboxamide |
| SMILES | O=C(N[C@@H]1CCC[C@@H]1F)C1=CCCCC1 |
| InChI | InChI=1S/C12H18FNO/c13-10-7-4-8-11(10)14-12(15)9-5-2-1-3-6-9/h5,10-11H,1-4,6-8H2,(H,14,15)/t10-,11+/m0/s1 |
| InChIKey | XJZFCXPWAPYIPA-WDEREUQCSA-N |
| XLogP | 2.49 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.28 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |