C10H9FN2O — CID 12859029
4-fluoro-5-(4-methylphenyl)-1,2-dihydropyrazol-3-one (PubChem CID 12859029) has the molecular formula C10H9FN2O and a molecular weight of 192.19 g/mol. Its IUPAC name is 4-fluoro-5-(4-methylphenyl)-1,2-dihydropyrazol-3-one.
| Compound Name | 4-fluoro-5-(4-methylphenyl)-1,2-dihydropyrazol-3-one |
|---|---|
| PubChem CID | 12859029 |
| Molecular Formula | C10H9FN2O |
| Molecular Weight | 192.19 g/mol |
| Exact Mass | 192.07 |
| IUPAC Name | 4-fluoro-5-(4-methylphenyl)-1,2-dihydropyrazol-3-one |
| SMILES | Cc1ccc(-c2[nH][nH]c(=O)c2F)cc1 |
| InChI | InChI=1S/C10H9FN2O/c1-6-2-4-7(5-3-6)9-8(11)10(14)13-12-9/h2-5H,1H3,(H2,12,13,14) |
| InChIKey | CSEYAVURNUICRP-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 48.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.19 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |