C13H8Br2ClNO — CID 1286593
2,4-dibromo-6-[(2-chlorophenyl)iminomethyl]phenol (PubChem CID 1286593) has the molecular formula C13H8Br2ClNO and a molecular weight of 389.47 g/mol. Its IUPAC name is 2,4-dibromo-6-[(2-chlorophenyl)iminomethyl]phenol.
| Compound Name | 2,4-dibromo-6-[(2-chlorophenyl)iminomethyl]phenol |
|---|---|
| PubChem CID | 1286593 |
| Molecular Formula | C13H8Br2ClNO |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 386.87 |
| IUPAC Name | 2,4-dibromo-6-[(2-chlorophenyl)iminomethyl]phenol |
| SMILES | Oc1c(Br)cc(Br)cc1/C=N/c1ccccc1Cl |
| InChI | InChI=1S/C13H8Br2ClNO/c14-9-5-8(13(18)10(15)6-9)7-17-12-4-2-1-3-11(12)16/h1-7,18H/b17-7+ |
| InChIKey | QUDHORHEMHURQB-REZTVBANSA-N |
| XLogP | 5.32 |
| TPSA | 32.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|