C18H24N4O — CID 128660734
1-cyclohexyl-N-(5-methyl-1H-indazol-6-yl)azetidine-3-carboxamide (PubChem CID 128660734) has the molecular formula C18H24N4O and a molecular weight of 312.42 g/mol. Its IUPAC name is 1-cyclohexyl-N-(5-methyl-1H-indazol-6-yl)azetidine-3-carboxamide.
| Compound Name | 1-cyclohexyl-N-(5-methyl-1H-indazol-6-yl)azetidine-3-carboxamide |
|---|---|
| PubChem CID | 128660734 |
| Molecular Formula | C18H24N4O |
| Molecular Weight | 312.42 g/mol |
| Exact Mass | 312.20 |
| IUPAC Name | 1-cyclohexyl-N-(5-methyl-1H-indazol-6-yl)azetidine-3-carboxamide |
| SMILES | Cc1cc2cn[nH]c2cc1NC(=O)C1CN(C2CCCCC2)C1 |
| InChI | InChI=1S/C18H24N4O/c1-12-7-13-9-19-21-17(13)8-16(12)20-18(23)14-10-22(11-14)15-5-3-2-4-6-15/h7-9,14-15H,2-6,10-11H2,1H3,(H,19,21)(H,20,23) |
| InChIKey | APGBMSDLUJEJOW-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 61.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.42 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |