C16H20N4O2S — CID 155949921
3-butanoyl-N-(6-methyl-1H-indazol-5-yl)-1,3-thiazolidine-4-carboxamide (PubChem CID 155949921) has the molecular formula C16H20N4O2S and a molecular weight of 332.43 g/mol. Its IUPAC name is 3-butanoyl-N-(6-methyl-1H-indazol-5-yl)-1,3-thiazolidine-4-carboxamide.
| Compound Name | 3-butanoyl-N-(6-methyl-1H-indazol-5-yl)-1,3-thiazolidine-4-carboxamide |
|---|---|
| PubChem CID | 155949921 |
| Molecular Formula | C16H20N4O2S |
| Molecular Weight | 332.43 g/mol |
| Exact Mass | 332.13 |
| IUPAC Name | 3-butanoyl-N-(6-methyl-1H-indazol-5-yl)-1,3-thiazolidine-4-carboxamide |
| SMILES | CCCC(=O)N1CSCC1C(=O)Nc1cc2cn[nH]c2cc1C |
| InChI | InChI=1S/C16H20N4O2S/c1-3-4-15(21)20-9-23-8-14(20)16(22)18-12-6-11-7-17-19-13(11)5-10(12)2/h5-7,14H,3-4,8-9H2,1-2H3,(H,17,19)(H,18,22) |
| InChIKey | FPUSLCBFLWDNGM-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 78.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.43 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |