C16H20N2O4S — CID 119255305
5-[(3-butanoyl-1,3-thiazolidine-4-carbonyl)amino]-2-methylbenzoic acid (PubChem CID 119255305) has the molecular formula C16H20N2O4S and a molecular weight of 336.41 g/mol. Its IUPAC name is 5-[(3-butanoyl-1,3-thiazolidine-4-carbonyl)amino]-2-methylbenzoic acid.
| Compound Name | 5-[(3-butanoyl-1,3-thiazolidine-4-carbonyl)amino]-2-methylbenzoic acid |
|---|---|
| PubChem CID | 119255305 |
| Molecular Formula | C16H20N2O4S |
| Molecular Weight | 336.41 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 5-[(3-butanoyl-1,3-thiazolidine-4-carbonyl)amino]-2-methylbenzoic acid |
| SMILES | CCCC(=O)N1CSCC1C(=O)Nc1ccc(C)c(C(=O)O)c1 |
| InChI | InChI=1S/C16H20N2O4S/c1-3-4-14(19)18-9-23-8-13(18)15(20)17-11-6-5-10(2)12(7-11)16(21)22/h5-7,13H,3-4,8-9H2,1-2H3,(H,17,20)(H,21,22) |
| InChIKey | DGRJUCOPDIAJNL-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.41 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |