C17H22N2O4S — CID 119255264
2-methyl-5-[(3-pentanoyl-1,3-thiazolidine-4-carbonyl)amino]benzoic acid (PubChem CID 119255264) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is 2-methyl-5-[(3-pentanoyl-1,3-thiazolidine-4-carbonyl)amino]benzoic acid.
| Compound Name | 2-methyl-5-[(3-pentanoyl-1,3-thiazolidine-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 119255264 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | 2-methyl-5-[(3-pentanoyl-1,3-thiazolidine-4-carbonyl)amino]benzoic acid |
| SMILES | CCCCC(=O)N1CSCC1C(=O)Nc1ccc(C)c(C(=O)O)c1 |
| InChI | InChI=1S/C17H22N2O4S/c1-3-4-5-15(20)19-10-24-9-14(19)16(21)18-12-7-6-11(2)13(8-12)17(22)23/h6-8,14H,3-5,9-10H2,1-2H3,(H,18,21)(H,22,23) |
| InChIKey | QUOQKLAHGSPBNB-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |