C15H18N2O4S — CID 119219604
3-[(3-butanoyl-1,3-thiazolidine-4-carbonyl)amino]benzoic acid (PubChem CID 119219604) has the molecular formula C15H18N2O4S and a molecular weight of 322.39 g/mol. Its IUPAC name is 3-[(3-butanoyl-1,3-thiazolidine-4-carbonyl)amino]benzoic acid.
| Compound Name | 3-[(3-butanoyl-1,3-thiazolidine-4-carbonyl)amino]benzoic acid |
|---|---|
| PubChem CID | 119219604 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.10 |
| IUPAC Name | 3-[(3-butanoyl-1,3-thiazolidine-4-carbonyl)amino]benzoic acid |
| SMILES | CCCC(=O)N1CSCC1C(=O)Nc1cccc(C(=O)O)c1 |
| InChI | InChI=1S/C15H18N2O4S/c1-2-4-13(18)17-9-22-8-12(17)14(19)16-11-6-3-5-10(7-11)15(20)21/h3,5-7,12H,2,4,8-9H2,1H3,(H,16,19)(H,20,21) |
| InChIKey | MLWCZNVNAWFKFF-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |