C15H26N2O4S — CID 119227531
7-[(3-butanoyl-1,3-thiazolidine-4-carbonyl)amino]heptanoic acid (PubChem CID 119227531) has the molecular formula C15H26N2O4S and a molecular weight of 330.45 g/mol. Its IUPAC name is 7-[(3-butanoyl-1,3-thiazolidine-4-carbonyl)amino]heptanoic acid.
| Compound Name | 7-[(3-butanoyl-1,3-thiazolidine-4-carbonyl)amino]heptanoic acid |
|---|---|
| PubChem CID | 119227531 |
| Molecular Formula | C15H26N2O4S |
| Molecular Weight | 330.45 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 7-[(3-butanoyl-1,3-thiazolidine-4-carbonyl)amino]heptanoic acid |
| SMILES | CCCC(=O)N1CSCC1C(=O)NCCCCCCC(=O)O |
| InChI | InChI=1S/C15H26N2O4S/c1-2-7-13(18)17-11-22-10-12(17)15(21)16-9-6-4-3-5-8-14(19)20/h12H,2-11H2,1H3,(H,16,21)(H,19,20) |
| InChIKey | GSLLEQICQRTLBD-UHFFFAOYSA-N |
| XLogP | 1.84 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.45 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|