C17H29N3O6 — CID 54523220
5-[[(2R)-4-hydroxy-1-[2-(pentanoylamino)acetyl]pyrrolidine-2-carbonyl]amino]pentanoic acid (PubChem CID 54523220) has the molecular formula C17H29N3O6 and a molecular weight of 371.43 g/mol. Its IUPAC name is 5-[[(2R)-4-hydroxy-1-[2-(pentanoylamino)acetyl]pyrrolidine-2-carbonyl]amino]pentanoic acid.
| Compound Name | 5-[[(2R)-4-hydroxy-1-[2-(pentanoylamino)acetyl]pyrrolidine-2-carbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 54523220 |
| Molecular Formula | C17H29N3O6 |
| Molecular Weight | 371.43 g/mol |
| Exact Mass | 371.21 |
| IUPAC Name | 5-[[(2R)-4-hydroxy-1-[2-(pentanoylamino)acetyl]pyrrolidine-2-carbonyl]amino]pentanoic acid |
| SMILES | CCCCC(=O)NCC(=O)N1CC(O)C[C@@H]1C(=O)NCCCCC(=O)O |
| InChI | InChI=1S/C17H29N3O6/c1-2-3-6-14(22)19-10-15(23)20-11-12(21)9-13(20)17(26)18-8-5-4-7-16(24)25/h12-13,21H,2-11H2,1H3,(H,18,26)(H,19,22)(H,24,25)/t12?,13-/m1/s1 |
| InChIKey | YRHSSOBMAXYWAX-ZGTCLIOFSA-N |
| XLogP | -0.37 |
| TPSA | 136.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.43 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|