C31H41N3O6 — CID 67865847
benzyl 5-[[(2S)-1-[2-(pentanoylamino)acetyl]-4-phenylmethoxypyrrolidine-2-carbonyl]amino]pentanoate (PubChem CID 67865847) has the molecular formula C31H41N3O6 and a molecular weight of 551.68 g/mol. Its IUPAC name is benzyl 5-[[(2S)-1-[2-(pentanoylamino)acetyl]-4-phenylmethoxypyrrolidine-2-carbonyl]amino]pentanoate.
| Compound Name | benzyl 5-[[(2S)-1-[2-(pentanoylamino)acetyl]-4-phenylmethoxypyrrolidine-2-carbonyl]amino]pentanoate |
|---|---|
| PubChem CID | 67865847 |
| Molecular Formula | C31H41N3O6 |
| Molecular Weight | 551.68 g/mol |
| Exact Mass | 551.30 |
| IUPAC Name | benzyl 5-[[(2S)-1-[2-(pentanoylamino)acetyl]-4-phenylmethoxypyrrolidine-2-carbonyl]amino]pentanoate |
| SMILES | CCCCC(=O)NCC(=O)N1CC(OCc2ccccc2)C[C@H]1C(=O)NCCCCC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C31H41N3O6/c1-2-3-16-28(35)33-20-29(36)34-21-26(39-22-24-12-6-4-7-13-24)19-27(34)31(38)32-18-11-10-17-30(37)40-23-25-14-8-5-9-15-25/h4-9,12-15,26-27H,2-3,10-11,16-23H2,1H3,(H,32,38)(H,33,35)/t26?,27-/m0/s1 |
| InChIKey | PTDMMSNQOFJGMV-GEVKEYJPSA-N |
| XLogP | 3.51 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.68 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|