C12H20N2O4S — CID 61143319
(4R)-3-(6-acetamidohexanoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 61143319) has the molecular formula C12H20N2O4S and a molecular weight of 288.37 g/mol. Its IUPAC name is (4R)-3-(6-acetamidohexanoyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(6-acetamidohexanoyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 61143319 |
| Molecular Formula | C12H20N2O4S |
| Molecular Weight | 288.37 g/mol |
| Exact Mass | 288.11 |
| IUPAC Name | (4R)-3-(6-acetamidohexanoyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | CC(=O)NCCCCCC(=O)N1CSC[C@H]1C(=O)O |
| InChI | InChI=1S/C12H20N2O4S/c1-9(15)13-6-4-2-3-5-11(16)14-8-19-7-10(14)12(17)18/h10H,2-8H2,1H3,(H,13,15)(H,17,18)/t10-/m0/s1 |
| InChIKey | DFJLQJQJLGLJQB-JTQLQIEISA-N |
| XLogP | 0.67 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.37 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|