About 3-(3-aminopropanoyl)-1,3-thiazolidine-4-carboxylic acid
3-(3-aminopropanoyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 61157082) has the molecular formula C7H12N2O3S
and a molecular weight of 204.25 g/mol. Its IUPAC name is 3-(3-aminopropanoyl)-1,3-thiazolidine-4-carboxylic acid.
Analyze 3-(3-aminopropanoyl)-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-aminopropanoyl)-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of 3-(3-aminopropanoyl)-1,3-thiazolidine-4-carboxylic acid (CID 61157082) is 3-(3-aminopropanoyl)-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for 3-(3-aminopropanoyl)-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for 3-(3-aminopropanoyl)-1,3-thiazolidine-4-carboxylic acid is NCCC(=O)N1CSCC1C(=O)O.
What is the InChIKey of 3-(3-aminopropanoyl)-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is CGVFJVUWDRQWGZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N2O3S/c8-2-1-6(10)9-4-13-3-5(9)7(11)12/h5H,1-4,8H2,(H,11,12).
What are the key properties of 3-(3-aminopropanoyl)-1,3-thiazolidine-4-carboxylic acid?
3-(3-aminopropanoyl)-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 204.25 g/mol, XLogP of -0.68, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-aminopropanoyl)-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 61157082), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).