About (4R)-3-(2-aminoacetyl)-1,3-thiazolidine-4-carboxylic acid
(4R)-3-(2-aminoacetyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 61161157) has the molecular formula C6H10N2O3S
and a molecular weight of 190.22 g/mol. Its IUPAC name is (4R)-3-(2-aminoacetyl)-1,3-thiazolidine-4-carboxylic acid.
Analyze (4R)-3-(2-aminoacetyl)-1,3-thiazolidine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-3-(2-aminoacetyl)-1,3-thiazolidine-4-carboxylic acid?
The IUPAC name of (4R)-3-(2-aminoacetyl)-1,3-thiazolidine-4-carboxylic acid (CID 61161157) is (4R)-3-(2-aminoacetyl)-1,3-thiazolidine-4-carboxylic acid.
What is the SMILES notation for (4R)-3-(2-aminoacetyl)-1,3-thiazolidine-4-carboxylic acid?
The canonical SMILES for (4R)-3-(2-aminoacetyl)-1,3-thiazolidine-4-carboxylic acid is NCC(=O)N1CSC[C@H]1C(=O)O.
What is the InChIKey of (4R)-3-(2-aminoacetyl)-1,3-thiazolidine-4-carboxylic acid?
The InChIKey is RRRGIFISXYCWLG-BYPYZUCNSA-N. The full InChI is InChI=1S/C6H10N2O3S/c7-1-5(9)8-3-12-2-4(8)6(10)11/h4H,1-3,7H2,(H,10,11)/t4-/m0/s1.
What are the key properties of (4R)-3-(2-aminoacetyl)-1,3-thiazolidine-4-carboxylic acid?
(4R)-3-(2-aminoacetyl)-1,3-thiazolidine-4-carboxylic acid has a molecular weight of 190.22 g/mol, XLogP of -1.07, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-3-(2-aminoacetyl)-1,3-thiazolidine-4-carboxylic acid is sourced from PubChem (CID 61161157), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).