C6H8ClNO3S — CID 93494384
(4R)-3-(2-chloroacetyl)-1,3-thiazolidine-4-carboxylic acid (PubChem CID 93494384) has the molecular formula C6H8ClNO3S and a molecular weight of 209.65 g/mol. Its IUPAC name is (4R)-3-(2-chloroacetyl)-1,3-thiazolidine-4-carboxylic acid.
| Compound Name | (4R)-3-(2-chloroacetyl)-1,3-thiazolidine-4-carboxylic acid |
|---|---|
| PubChem CID | 93494384 |
| Molecular Formula | C6H8ClNO3S |
| Molecular Weight | 209.65 g/mol |
| Exact Mass | 208.99 |
| IUPAC Name | (4R)-3-(2-chloroacetyl)-1,3-thiazolidine-4-carboxylic acid |
| SMILES | O=C(O)[C@@H]1CSCN1C(=O)CCl |
| InChI | InChI=1S/C6H8ClNO3S/c7-1-5(9)8-3-12-2-4(8)6(10)11/h4H,1-3H2,(H,10,11)/t4-/m0/s1 |
| InChIKey | IQUNAOSVGUETJE-BYPYZUCNSA-N |
| XLogP | 0.21 |
| TPSA | 57.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.65 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|