C8H15NOS — CID 12866703
2-pentyl-1,3-thiazolidin-4-one (PubChem CID 12866703) has the molecular formula C8H15NOS and a molecular weight of 173.28 g/mol. Its IUPAC name is 2-pentyl-1,3-thiazolidin-4-one.
| Compound Name | 2-pentyl-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 12866703 |
| Molecular Formula | C8H15NOS |
| Molecular Weight | 173.28 g/mol |
| Exact Mass | 173.09 |
| IUPAC Name | 2-pentyl-1,3-thiazolidin-4-one |
| SMILES | CCCCCC1NC(=O)CS1 |
| InChI | InChI=1S/C8H15NOS/c1-2-3-4-5-8-9-7(10)6-11-8/h8H,2-6H2,1H3,(H,9,10) |
| InChIKey | MQVSAMVREZMQBK-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.28 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|