C16H18N4S — CID 12867035
4-[4-(dimethylamino)phenyl]-3-methyl-4H-pyrido[1,2-a][1,3,5]triazine-2-thione (PubChem CID 12867035) has the molecular formula C16H18N4S and a molecular weight of 298.42 g/mol. Its IUPAC name is 4-[4-(dimethylamino)phenyl]-3-methyl-4H-pyrido[1,2-a][1,3,5]triazine-2-thione.
| Compound Name | 4-[4-(dimethylamino)phenyl]-3-methyl-4H-pyrido[1,2-a][1,3,5]triazine-2-thione |
|---|---|
| PubChem CID | 12867035 |
| Molecular Formula | C16H18N4S |
| Molecular Weight | 298.42 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 4-[4-(dimethylamino)phenyl]-3-methyl-4H-pyrido[1,2-a][1,3,5]triazine-2-thione |
| SMILES | CN(C)c1ccc(C2N(C)C(=S)N=C3C=CC=CN32)cc1 |
| InChI | InChI=1S/C16H18N4S/c1-18(2)13-9-7-12(8-10-13)15-19(3)16(21)17-14-6-4-5-11-20(14)15/h4-11,15H,1-3H3 |
| InChIKey | DATCHERAIOFLLB-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 22.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.42 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|