C36H29F3N2O3S — CID 12869648
1,2,4,5-tetraphenyl-3-(1-phenylethyl)imidazol-3-ium;trifluoromethanesulfonate (PubChem CID 12869648) has the molecular formula C36H29F3N2O3S and a molecular weight of 626.70 g/mol. Its IUPAC name is 1,2,4,5-tetraphenyl-3-(1-phenylethyl)imidazol-3-ium;trifluoromethanesulfonate.
| Compound Name | 1,2,4,5-tetraphenyl-3-(1-phenylethyl)imidazol-3-ium;trifluoromethanesulfonate |
|---|---|
| PubChem CID | 12869648 |
| Molecular Formula | C36H29F3N2O3S |
| Molecular Weight | 626.70 g/mol |
| Exact Mass | 626.19 |
| IUPAC Name | 1,2,4,5-tetraphenyl-3-(1-phenylethyl)imidazol-3-ium;trifluoromethanesulfonate |
| SMILES | CC(c1ccccc1)[n+]1c(-c2ccccc2)c(-c2ccccc2)n(-c2ccccc2)c1-c1ccccc1.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C35H29N2.CHF3O3S/c1-27(28-17-7-2-8-18-28)36-33(29-19-9-3-10-20-29)34(30-21-11-4-12-22-30)37(32-25-15-6-16-26-32)35(36)31-23-13-5-14-24-31;2-1(3,4)8(5,6)7/h2-27H,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | HNQCXKJWIYRCCR-UHFFFAOYSA-M |
| XLogP | 8.43 |
| TPSA | 66.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 626.70 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|