C17H22N2O2S — CID 128708036
N-(5-tert-butyl-3-cyanothiophen-2-yl)-3-methyl-4-oxocyclohexane-1-carboxamide (PubChem CID 128708036) has the molecular formula C17H22N2O2S and a molecular weight of 318.44 g/mol. Its IUPAC name is N-(5-tert-butyl-3-cyanothiophen-2-yl)-3-methyl-4-oxocyclohexane-1-carboxamide.
| Compound Name | N-(5-tert-butyl-3-cyanothiophen-2-yl)-3-methyl-4-oxocyclohexane-1-carboxamide |
|---|---|
| PubChem CID | 128708036 |
| Molecular Formula | C17H22N2O2S |
| Molecular Weight | 318.44 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | N-(5-tert-butyl-3-cyanothiophen-2-yl)-3-methyl-4-oxocyclohexane-1-carboxamide |
| SMILES | CC1CC(C(=O)Nc2sc(C(C)(C)C)cc2C#N)CCC1=O |
| InChI | InChI=1S/C17H22N2O2S/c1-10-7-11(5-6-13(10)20)15(21)19-16-12(9-18)8-14(22-16)17(2,3)4/h8,10-11H,5-7H2,1-4H3,(H,19,21) |
| InChIKey | TVQOKCDUTPVSNN-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |